CAS 289472-81-7 appears in our catalog under these names: Bortezomib Impurity 48, (S)-Hydroxy Des(boric Acid) Bortezomib. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 0,5mg, 5mg.
N-[(2S)-1-[[(1S)-1-hydroxy-3-methylbutyl]amino]-1-oxo-3-phenylpropan-2-yl]pyrazine-2-carboxamide (CAS 289472-81-7) is a chemical compound with the molecular formula C19H24N4O3 and a molecular weight of 356.4 g/mol. IUPAC name: N-[(2S)-1-[[(1S)-1-hydroxy-3-methylbutyl]amino]-1-oxo-3-phenylpropan-2-yl]pyrazine-2-carboxamide. InChIKey: NEIDLJIPMZVISC-RDJZCZTQSA-N.
| Molecular formula | C19H24N4O3 |
|---|---|
| Molecular weight | 356.4 g/mol |
| IUPAC name | N-[(2S)-1-[[(1S)-1-hydroxy-3-methylbutyl]amino]-1-oxo-3-phenylpropan-2-yl]pyrazine-2-carboxamide |
| InChIKey | NEIDLJIPMZVISC-RDJZCZTQSA-N |
| SMILES | CC(C)C[C@@H](NC(=O)[C@H](CC1=CC=CC=C1)NC(=O)C2=NC=CN=C2)O |
Computed by PubChem (NCBI)