CAS 289476-03-5 is the registry number for 3,5-dinitro 4-benzylpiperazinyl ketone. Offered by: Biosynth. Available pack sizes: 250mg.
(4-benzylpiperazin-1-yl)-(3,5-dinitrophenyl)methanone (CAS 289476-03-5) is a chemical compound with the molecular formula C18H18N4O5 and a molecular weight of 370.4 g/mol. IUPAC name: (4-benzylpiperazin-1-yl)-(3,5-dinitrophenyl)methanone. InChIKey: XWSINDZIARKWDJ-UHFFFAOYSA-N.
| Molecular formula | C18H18N4O5 |
|---|---|
| Molecular weight | 370.4 g/mol |
| IUPAC name | (4-benzylpiperazin-1-yl)-(3,5-dinitrophenyl)methanone |
| InChIKey | XWSINDZIARKWDJ-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1CC2=CC=CC=C2)C(=O)C3=CC(=CC(=C3)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)