CAS 2894830-14-7 is the registry number for Sodium 2-((tert-butoxycarbonyl)amino)ethane-1-sulfonate 95+%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
Sodium 2-[(2-methylpropan-2-yl)oxycarbonylamino]ethanesulfonate (CAS 2894830-14-7) is a chemical compound with the molecular formula C7H14NNaO5S and a molecular weight of 247.25 g/mol. IUPAC name: sodium 2-[(2-methylpropan-2-yl)oxycarbonylamino]ethanesulfonate. InChIKey: DOJLUOCSIRZEQQ-UHFFFAOYSA-M.
| Molecular formula | C7H14NNaO5S |
|---|---|
| Molecular weight | 247.25 g/mol |
| IUPAC name | sodium 2-[(2-methylpropan-2-yl)oxycarbonylamino]ethanesulfonate |
| InChIKey | DOJLUOCSIRZEQQ-UHFFFAOYSA-M |
| SMILES | CC(C)(C)OC(=O)NCCS(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)