CAS 2894834-77-4 is the registry number for (S)-1-(4-Chlorothiazol-2-yl)ethan-1-amine hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S)-1-(4-chloro-1,3-thiazol-2-yl)ethanamine;hydrochloride (CAS 2894834-77-4) is a chemical compound with the molecular formula C5H8Cl2N2S and a molecular weight of 199.10 g/mol. IUPAC name: (1S)-1-(4-chloro-1,3-thiazol-2-yl)ethanamine;hydrochloride. InChIKey: KHCWVRRDFXEOOJ-DFWYDOINSA-N.
| Molecular formula | C5H8Cl2N2S |
|---|---|
| Molecular weight | 199.10 g/mol |
| IUPAC name | (1S)-1-(4-chloro-1,3-thiazol-2-yl)ethanamine;hydrochloride |
| InChIKey | KHCWVRRDFXEOOJ-DFWYDOINSA-N |
| SMILES | C[C@@H](C1=NC(=CS1)Cl)N.Cl |
Computed by PubChem (NCBI)