CAS 2895-07-0 appears in our catalog under these names: 1,1,3,3,5,5,5–Heptamethylpentanetrisiloxane, 1,1,1,3,3,5,5-Heptamethyltrisiloxane, ≥90%. Offered by: GLPBio, Fluorochem. Available pack sizes: 10g, 25g, 5g.
CAS 2895-07-0 identifies a chemical compound with the molecular formula C7H21O2Si3 and a molecular weight of 221.50 g/mol. InChIKey: GDDVTIGTERZVBW-UHFFFAOYSA-N.
| Molecular formula | C7H21O2Si3 |
|---|---|
| Molecular weight | 221.50 g/mol |
| InChIKey | GDDVTIGTERZVBW-UHFFFAOYSA-N |
| SMILES | C[Si](C)O[Si](C)(C)O[Si](C)(C)C |
Computed by PubChem (NCBI)