CAS 28955-70-6 appears in our catalog under these names: 4-Hydroxybenzo(d)oxazol-2(3H)-one, 97%, 1,3-Benzoxazole-2,4-diol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
4-hydroxy-3H-1,3-benzoxazol-2-one (CAS 28955-70-6) is a chemical compound with the molecular formula C7H5NO3 and a molecular weight of 151.12 g/mol. IUPAC name: 4-hydroxy-3H-1,3-benzoxazol-2-one. InChIKey: SXQYJGZBZLNTLH-UHFFFAOYSA-N.
| Molecular formula | C7H5NO3 |
|---|---|
| Molecular weight | 151.12 g/mol |
| IUPAC name | 4-hydroxy-3H-1,3-benzoxazol-2-one |
| InChIKey | SXQYJGZBZLNTLH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)OC(=O)N2)O |
Computed by PubChem (NCBI)