CAS 2896084-03-8 is the registry number for 4-(2,2,2-Trifluoroethyl)thiazole-2-carbaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(2,2,2-trifluoroethyl)-1,3-thiazole-2-carbaldehyde (CAS 2896084-03-8) is a chemical compound with the molecular formula C6H4F3NOS and a molecular weight of 195.16 g/mol. IUPAC name: 4-(2,2,2-trifluoroethyl)-1,3-thiazole-2-carbaldehyde. InChIKey: VABUGZXBCUDSBI-UHFFFAOYSA-N.
| Molecular formula | C6H4F3NOS |
|---|---|
| Molecular weight | 195.16 g/mol |
| IUPAC name | 4-(2,2,2-trifluoroethyl)-1,3-thiazole-2-carbaldehyde |
| InChIKey | VABUGZXBCUDSBI-UHFFFAOYSA-N |
| SMILES | C1=C(N=C(S1)C=O)CC(F)(F)F |
Computed by PubChem (NCBI)