Products 2896196-09-9
CAS 2896196-09-9 is the registry number for Antibacterial agent 174. Offered by: MedChemExpress. Available pack sizes: Get quote.
Sodium ethyl 7-(1-cyano-2-ethoxy-2-oxoethyl)-6-fluoro-1-octyl-4-oxoquinoline-3-carboxylate (CAS 2896196-09-9) is a chemical compound with the molecular formula C25H30FN2NaO5 and a molecular weight of 480.5 g/mol. IUPAC name: sodium ethyl 7-(1-cyano-2-ethoxy-2-oxoethyl)-6-fluoro-1-octyl-4-oxoquinoline-3-carboxylate. InChIKey: VZZYKODXNADEKN-UHFFFAOYSA-N.
| Molecular formula | C25H30FN2NaO5 |
|---|---|
| Molecular weight | 480.5 g/mol |
| IUPAC name | sodium ethyl 7-(1-cyano-2-ethoxy-2-oxoethyl)-6-fluoro-1-octyl-4-oxoquinoline-3-carboxylate |
| InChIKey | VZZYKODXNADEKN-UHFFFAOYSA-N |
| SMILES | CCCCCCCCN1C=C(C(=O)C2=CC(=C(C=C21)[C-](C#N)C(=O)OCC)F)C(=O)OCC.[Na+] |
Computed by PubChem (NCBI)
Synonyms:
Antibacterial agent 174, orb2567017