Products 2896209-47-3
CAS 2896209-47-3 is the registry number for Antifungal agent 51. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-(1H-benzimidazol-2-ylsulfanyl)-2-(4-fluorophenyl)-3-(1,2,4-triazol-1-yl)propan-2-ol (CAS 2896209-47-3) is a chemical compound with the molecular formula C18H16FN5OS and a molecular weight of 369.4 g/mol. IUPAC name: 1-(1H-benzimidazol-2-ylsulfanyl)-2-(4-fluorophenyl)-3-(1,2,4-triazol-1-yl)propan-2-ol. InChIKey: LUOGHIFDYWBLNG-UHFFFAOYSA-N.
| Molecular formula | C18H16FN5OS |
|---|---|
| Molecular weight | 369.4 g/mol |
| IUPAC name | 1-(1H-benzimidazol-2-ylsulfanyl)-2-(4-fluorophenyl)-3-(1,2,4-triazol-1-yl)propan-2-ol |
| InChIKey | LUOGHIFDYWBLNG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(=N2)SCC(CN3C=NC=N3)(C4=CC=C(C=C4)F)O |
Computed by PubChem (NCBI)
Synonyms:
Antifungal agent 51, orb1982579