CAS 289656-82-2 appears in our catalog under these names: 2,2-Bis(4-fluorophenyl)-2-phenylacetonitrile, 97%, 2,2-Bis(4-fluorophenyl)-2-phenylacetonitrile 95%, 2,2-Bis(4-fluorophenyl)-2-phenylacetonitrile, 95%, 95%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 50mg, 100mg, 250mg.
2,2-bis(4-fluorophenyl)-2-phenylacetonitrile (CAS 289656-82-2) is a chemical compound with the molecular formula C20H13F2N and a molecular weight of 305.3 g/mol. IUPAC name: 2,2-bis(4-fluorophenyl)-2-phenylacetonitrile. InChIKey: OIIGTIPIURUMQN-UHFFFAOYSA-N.
| Molecular formula | C20H13F2N |
|---|---|
| Molecular weight | 305.3 g/mol |
| IUPAC name | 2,2-bis(4-fluorophenyl)-2-phenylacetonitrile |
| InChIKey | OIIGTIPIURUMQN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C#N)(C2=CC=C(C=C2)F)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)