CAS 28968-64-1 appears in our catalog under these names: Boc-homoarg(no2)-oh, 98%, Boc–HoArg(NO2)–OH, Boc–HomoArg(NO2)–OH, Boc-HomoArg(NO2)-OH, ≥98%, ≥98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 10g, 250mg, 25g.
(2S)-6-[[amino(nitramido)methylidene]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid (CAS 28968-64-1) is a chemical compound with the molecular formula C12H23N5O6 and a molecular weight of 333.34 g/mol. IUPAC name: (2S)-6-[[amino(nitramido)methylidene]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid. InChIKey: YFIPSHDRWHZYOM-QMMMGPOBSA-N.
| Molecular formula | C12H23N5O6 |
|---|---|
| Molecular weight | 333.34 g/mol |
| IUPAC name | (2S)-6-[[amino(nitramido)methylidene]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
| InChIKey | YFIPSHDRWHZYOM-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCCCN=C(N)N[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)