CAS 289686-70-0 appears in our catalog under these names: 2–(3,5–bis(trifluoromethyl)phenyl)–2–methylpropanoic acid, 2-(3,5-Bis(trifluoromethyl)phenyl)-2-methylpropanoic acid, 95%, 95%, 2-(3,5-Bis(trifluoromethyl)phenyl)-2-methylpropanoic acid, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 10g, 25g, 100g, 500g.
2-[3,5-bis(trifluoromethyl)phenyl]-2-methylpropanoic acid (CAS 289686-70-0) is a chemical compound with the molecular formula C12H10F6O2 and a molecular weight of 300.20 g/mol. IUPAC name: 2-[3,5-bis(trifluoromethyl)phenyl]-2-methylpropanoic acid. InChIKey: ORLKRFYFNMCQIG-UHFFFAOYSA-N.
| Molecular formula | C12H10F6O2 |
|---|---|
| Molecular weight | 300.20 g/mol |
| IUPAC name | 2-[3,5-bis(trifluoromethyl)phenyl]-2-methylpropanoic acid |
| InChIKey | ORLKRFYFNMCQIG-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)