CAS 28973-34-4 is the registry number for Flupentixol Impurity 2. Offered by: Chemat Brand. Available pack sizes: on request.
9-prop-2-enylidene-2-(trifluoromethyl)thioxanthene (CAS 28973-34-4) is a chemical compound with the molecular formula C17H11F3S and a molecular weight of 304.3 g/mol. IUPAC name: 9-prop-2-enylidene-2-(trifluoromethyl)thioxanthene. InChIKey: UIMQNVZBCXVRPK-UHFFFAOYSA-N.
| Molecular formula | C17H11F3S |
|---|---|
| Molecular weight | 304.3 g/mol |
| IUPAC name | 9-prop-2-enylidene-2-(trifluoromethyl)thioxanthene |
| InChIKey | UIMQNVZBCXVRPK-UHFFFAOYSA-N |
| SMILES | C=CC=C1C2=CC=CC=C2SC3=C1C=C(C=C3)C(F)(F)F |
Computed by PubChem (NCBI)