Products 2897582-89-5
CAS 2897582-89-5 appears in our catalog under these names: δ8–THCPA–A, Δ8-THCPA-A. Offered by: GLPBio, MedChemExpress. Available pack sizes: 5mg, 1mg, 5 mg, 1 mg.
(6aR,10aR)-3-heptyl-1-hydroxy-6,6,9-trimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromene-2-carboxylic acid (CAS 2897582-89-5) is a chemical compound with the molecular formula C24H34O4 and a molecular weight of 386.5 g/mol. IUPAC name: (6aR,10aR)-3-heptyl-1-hydroxy-6,6,9-trimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromene-2-carboxylic acid. InChIKey: ZRDRIVBGSCOWRC-QZTJIDSGSA-N.
| Molecular formula | C24H34O4 |
|---|---|
| Molecular weight | 386.5 g/mol |
| IUPAC name | (6aR,10aR)-3-heptyl-1-hydroxy-6,6,9-trimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromene-2-carboxylic acid |
| InChIKey | ZRDRIVBGSCOWRC-QZTJIDSGSA-N |
| SMILES | CCCCCCCC1=CC2=C([C@@H]3CC(=CC[C@H]3C(O2)(C)C)C)C(=C1C(=O)O)O |
Computed by PubChem (NCBI)