Products 2897614-59-2
CAS 2897614-59-2 is the registry number for H-FluNox, 99.53%. Offered by: MedChemExpress. Available pack sizes: 1 mg, 5 mg, 10 mg.
3'-(4,4-difluoro-1-oxidopiperidin-1-ium-1-yl)-6'-hydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one (CAS 2897614-59-2) is a chemical compound with the molecular formula C25H19F2NO5 and a molecular weight of 451.4 g/mol. IUPAC name: 3'-(4,4-difluoro-1-oxidopiperidin-1-ium-1-yl)-6'-hydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one. InChIKey: ZSOXPWOQYGCCRX-UHFFFAOYSA-N.
| Molecular formula | C25H19F2NO5 |
|---|---|
| Molecular weight | 451.4 g/mol |
| IUPAC name | 3'-(4,4-difluoro-1-oxidopiperidin-1-ium-1-yl)-6'-hydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one |
| InChIKey | ZSOXPWOQYGCCRX-UHFFFAOYSA-N |
| SMILES | C1C[N+](CCC1(F)F)(C2=CC3=C(C=C2)C4(C5=C(O3)C=C(C=C5)O)C6=CC=CC=C6C(=O)O4)[O-] |
Computed by PubChem (NCBI)
Synonyms:
H-FluNox, orb3027484