CAS 2898-11-5 is the registry number for Medazepam Hydrochloride. Offered by: TRC. Available pack sizes: 100mg, 10mg.
7-chloro-1-methyl-5-phenyl-2,3-dihydro-1,4-benzodiazepine;hydrochloride (CAS 2898-11-5) is a chemical compound with the molecular formula C16H16Cl2N2 and a molecular weight of 307.2 g/mol. IUPAC name: 7-chloro-1-methyl-5-phenyl-2,3-dihydro-1,4-benzodiazepine;hydrochloride. InChIKey: XBWAZCLHZCFCGK-UHFFFAOYSA-N.
| Molecular formula | C16H16Cl2N2 |
|---|---|
| Molecular weight | 307.2 g/mol |
| IUPAC name | 7-chloro-1-methyl-5-phenyl-2,3-dihydro-1,4-benzodiazepine;hydrochloride |
| InChIKey | XBWAZCLHZCFCGK-UHFFFAOYSA-N |
| SMILES | CN1CCN=C(C2=C1C=CC(=C2)Cl)C3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)