CAS 28987-79-3 appears in our catalog under these names: 3-Tolylmagnesium bromide - 1.0 M in Tetrahydrofuran, m–Tolylmagnesium Bromide, m-Tolylmagnesium Bromide (19% in Tetrahydrofuran, ca. 1mol/L). Offered by: Biosynth, GLPBio, TCI. Available pack sizes: 100g, 50g, 250g, 100ml, 1l, 500ml.
Magnesium;methylbenzene;bromide (CAS 28987-79-3) is a chemical compound with the molecular formula C7H7BrMg and a molecular weight of 195.34 g/mol. IUPAC name: magnesium;methylbenzene;bromide. InChIKey: DTGWSLDWZAMJHU-UHFFFAOYSA-M.
| Molecular formula | C7H7BrMg |
|---|---|
| Molecular weight | 195.34 g/mol |
| IUPAC name | magnesium;methylbenzene;bromide |
| InChIKey | DTGWSLDWZAMJHU-UHFFFAOYSA-M |
| SMILES | CC1=CC=C[C-]=C1.[Mg+2].[Br-] |
Computed by PubChem (NCBI)