CAS 28990-85-4 appears in our catalog under these names: L-Pyroglutamic acid pentachlorophenyl ester, 95%, Pyr–OPcp, L-Pyroglutamic acid pentachlorophenyl ester. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 5g, 250mg, 1g, 1000mg, 2000mg, 5000mg.
(2,3,4,5,6-pentachlorophenyl) (2S)-5-oxopyrrolidine-2-carboxylate (CAS 28990-85-4) is a chemical compound with the molecular formula C11H6Cl5NO3 and a molecular weight of 377.4 g/mol. IUPAC name: (2,3,4,5,6-pentachlorophenyl) (2S)-5-oxopyrrolidine-2-carboxylate. InChIKey: ZKGMBAZWQLUSMW-VKHMYHEASA-N.
| Molecular formula | C11H6Cl5NO3 |
|---|---|
| Molecular weight | 377.4 g/mol |
| IUPAC name | (2,3,4,5,6-pentachlorophenyl) (2S)-5-oxopyrrolidine-2-carboxylate |
| InChIKey | ZKGMBAZWQLUSMW-VKHMYHEASA-N |
| SMILES | C1CC(=O)N[C@@H]1C(=O)OC2=C(C(=C(C(=C2Cl)Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)