CAS 289913-84-4 is the registry number for 4-(Pyrrolidin-1-yl)benzene-1,2-diamine. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
4-pyrrolidin-1-ylbenzene-1,2-diamine (CAS 289913-84-4) is a chemical compound with the molecular formula C10H15N3 and a molecular weight of 177.25 g/mol. IUPAC name: 4-pyrrolidin-1-ylbenzene-1,2-diamine. InChIKey: ZUVKDZFDEROKCL-UHFFFAOYSA-N.
| Molecular formula | C10H15N3 |
|---|---|
| Molecular weight | 177.25 g/mol |
| IUPAC name | 4-pyrrolidin-1-ylbenzene-1,2-diamine |
| InChIKey | ZUVKDZFDEROKCL-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C2=CC(=C(C=C2)N)N |
Computed by PubChem (NCBI)