CAS 28992-50-9 appears in our catalog under these names: Bis(1h-benzo[d][1,2,3]triazol-1-yl)methanimine, 95%, Bis(1H–benzo(d)(1,2,3)triazol–1–yl)methanimine. Offered by: Combi-blocks, GLPBio. Available pack sizes: 100mg, 250mg, 1g.
Bis(benzotriazol-1-yl)methanimine (CAS 28992-50-9) is a chemical compound with the molecular formula C13H9N7 and a molecular weight of 263.26 g/mol. IUPAC name: bis(benzotriazol-1-yl)methanimine. InChIKey: XULYYEAADFGYCX-UHFFFAOYSA-N.
| Molecular formula | C13H9N7 |
|---|---|
| Molecular weight | 263.26 g/mol |
| IUPAC name | bis(benzotriazol-1-yl)methanimine |
| InChIKey | XULYYEAADFGYCX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=NN2C(=N)N3C4=CC=CC=C4N=N3 |
Computed by PubChem (NCBI)