Products 28993-44-4
CAS 28993-44-4 is the registry number for 2,3-Dihydrobenzo[b][1,4]dioxine-2,3-diol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,3-dihydro-1,4-benzodioxine-2,3-diol (CAS 28993-44-4) is a chemical compound with the molecular formula C8H8O4 and a molecular weight of 168.15 g/mol. IUPAC name: 2,3-dihydro-1,4-benzodioxine-2,3-diol. InChIKey: OXKPADVJDHHVHQ-UHFFFAOYSA-N.
| Molecular formula | C8H8O4 |
|---|---|
| Molecular weight | 168.15 g/mol |
| IUPAC name | 2,3-dihydro-1,4-benzodioxine-2,3-diol |
| InChIKey | OXKPADVJDHHVHQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)OC(C(O2)O)O |
Computed by PubChem (NCBI)