CAS 28995-88-2 is the registry number for 1-Methyl-4-((phenylethynyl)sulfonyl)benzene, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
1-methyl-4-(2-phenylethynylsulfonyl)benzene (CAS 28995-88-2) is a chemical compound with the molecular formula C15H12O2S and a molecular weight of 256.3 g/mol. IUPAC name: 1-methyl-4-(2-phenylethynylsulfonyl)benzene. InChIKey: LCFRAXQOCAQFJR-UHFFFAOYSA-N.
| Molecular formula | C15H12O2S |
|---|---|
| Molecular weight | 256.3 g/mol |
| IUPAC name | 1-methyl-4-(2-phenylethynylsulfonyl)benzene |
| InChIKey | LCFRAXQOCAQFJR-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)C#CC2=CC=CC=C2 |
Computed by PubChem (NCBI)