Products 2901-44-2

CAS 2901-44-2 is the registry number for trans-4-Acetamidocyclohexaneacetic acid, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-(4-acetamidocyclohexyl)acetic acid (CAS 2901-44-2) is a chemical compound with the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. IUPAC name: 2-(4-acetamidocyclohexyl)acetic acid. InChIKey: WFVBDJQHTIBXHZ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H17NO3
Molecular weight199.25 g/mol
IUPAC name2-(4-acetamidocyclohexyl)acetic acid
InChIKeyWFVBDJQHTIBXHZ-UHFFFAOYSA-N
SMILESCC(=O)NC1CCC(CC1)CC(=O)O

Computed by PubChem (NCBI)