CAS 2901016-08-6 is the registry number for Tapinarof prodrug-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
[3-hydroxy-5-[(E)-2-phenylethenyl]-2-propan-2-ylphenyl] hydrogen sulfate (CAS 2901016-08-6) is a chemical compound with the molecular formula C17H18O5S and a molecular weight of 334.4 g/mol. IUPAC name: [3-hydroxy-5-[(E)-2-phenylethenyl]-2-propan-2-ylphenyl] hydrogen sulfate. InChIKey: CMEARIBUQIEFFI-CMDGGOBGSA-N.
| Molecular formula | C17H18O5S |
|---|---|
| Molecular weight | 334.4 g/mol |
| IUPAC name | [3-hydroxy-5-[(E)-2-phenylethenyl]-2-propan-2-ylphenyl] hydrogen sulfate |
| InChIKey | CMEARIBUQIEFFI-CMDGGOBGSA-N |
| SMILES | CC(C)C1=C(C=C(C=C1OS(=O)(=O)O)/C=C/C2=CC=CC=C2)O |
Computed by PubChem (NCBI)