Products 2901016-08-6

CAS 2901016-08-6 is the registry number for Tapinarof prodrug-1. Offered by: MedChemExpress. Available pack sizes: Get quote.

Structural formula: {0} (CAS {1})

[3-hydroxy-5-[(E)-2-phenylethenyl]-2-propan-2-ylphenyl] hydrogen sulfate (CAS 2901016-08-6) is a chemical compound with the molecular formula C17H18O5S and a molecular weight of 334.4 g/mol. IUPAC name: [3-hydroxy-5-[(E)-2-phenylethenyl]-2-propan-2-ylphenyl] hydrogen sulfate. InChIKey: CMEARIBUQIEFFI-CMDGGOBGSA-N.

Identity
Molecular formulaC17H18O5S
Molecular weight334.4 g/mol
IUPAC name[3-hydroxy-5-[(E)-2-phenylethenyl]-2-propan-2-ylphenyl] hydrogen sulfate
InChIKeyCMEARIBUQIEFFI-CMDGGOBGSA-N
SMILESCC(C)C1=C(C=C(C=C1OS(=O)(=O)O)/C=C/C2=CC=CC=C2)O

Computed by PubChem (NCBI)

Synonyms: orb3136044