CAS 2901065-53-8 is the registry number for (2,4-dichloro-1,3-phenylene)bis(methylsulfane), 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1,3-dichloro-2,4-bis(methylsulfanyl)benzene (CAS 2901065-53-8) is a chemical compound with the molecular formula C8H8Cl2S2 and a molecular weight of 239.2 g/mol. IUPAC name: 1,3-dichloro-2,4-bis(methylsulfanyl)benzene. InChIKey: PSRYCCKXLSBHPB-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2S2 |
|---|---|
| Molecular weight | 239.2 g/mol |
| IUPAC name | 1,3-dichloro-2,4-bis(methylsulfanyl)benzene |
| InChIKey | PSRYCCKXLSBHPB-UHFFFAOYSA-N |
| SMILES | CSC1=C(C(=C(C=C1)Cl)SC)Cl |
Computed by PubChem (NCBI)