CAS 2901065-77-6 is the registry number for 2-(2,4-dichloro-3-(methylthio)phenyl)-2-methyl-1,3-dioxolane, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-(2,4-dichloro-3-methylsulfanylphenyl)-2-methyl-1,3-dioxolane (CAS 2901065-77-6) is a chemical compound with the molecular formula C11H12Cl2O2S and a molecular weight of 279.2 g/mol. IUPAC name: 2-(2,4-dichloro-3-methylsulfanylphenyl)-2-methyl-1,3-dioxolane. InChIKey: PWQJBKULJCWRMT-UHFFFAOYSA-N.
| Molecular formula | C11H12Cl2O2S |
|---|---|
| Molecular weight | 279.2 g/mol |
| IUPAC name | 2-(2,4-dichloro-3-methylsulfanylphenyl)-2-methyl-1,3-dioxolane |
| InChIKey | PWQJBKULJCWRMT-UHFFFAOYSA-N |
| SMILES | CC1(OCCO1)C2=C(C(=C(C=C2)Cl)SC)Cl |
Computed by PubChem (NCBI)