Products 2901066-18-8

CAS 2901066-18-8 is the registry number for 1-bromo-4-(2,2-diethoxyethoxy)-2,3-difluorobenzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

1-bromo-4-(2,2-diethoxyethoxy)-2,3-difluorobenzene (CAS 2901066-18-8) is a chemical compound with the molecular formula C12H15BrF2O3 and a molecular weight of 325.15 g/mol. IUPAC name: 1-bromo-4-(2,2-diethoxyethoxy)-2,3-difluorobenzene. InChIKey: MDDCKSBYIHFLSB-UHFFFAOYSA-N.

Identity
Molecular formulaC12H15BrF2O3
Molecular weight325.15 g/mol
IUPAC name1-bromo-4-(2,2-diethoxyethoxy)-2,3-difluorobenzene
InChIKeyMDDCKSBYIHFLSB-UHFFFAOYSA-N
SMILESCCOC(COC1=C(C(=C(C=C1)Br)F)F)OCC

Computed by PubChem (NCBI)