Products 2901066-44-0

CAS 2901066-44-0 is the registry number for methyl 5-iodo-3-(trifluoromethyl)benzo[b]thiophene-2-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 5-iodo-3-(trifluoromethyl)-1-benzothiophene-2-carboxylate (CAS 2901066-44-0) is a chemical compound with the molecular formula C11H6F3IO2S and a molecular weight of 386.13 g/mol. IUPAC name: methyl 5-iodo-3-(trifluoromethyl)-1-benzothiophene-2-carboxylate. InChIKey: FNAMGXAQYJNUSA-UHFFFAOYSA-N.

Identity
Molecular formulaC11H6F3IO2S
Molecular weight386.13 g/mol
IUPAC namemethyl 5-iodo-3-(trifluoromethyl)-1-benzothiophene-2-carboxylate
InChIKeyFNAMGXAQYJNUSA-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(C2=C(S1)C=CC(=C2)I)C(F)(F)F

Computed by PubChem (NCBI)