CAS 2901081-78-3 is the registry number for 2,2-Dichloro-1-(2,6-dichloropyridin-3-yl)ethanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2,2-dichloro-1-(2,6-dichloro-3-pyridinyl)ethanol (CAS 2901081-78-3) is a chemical compound with the molecular formula C7H5Cl4NO and a molecular weight of 260.9 g/mol. IUPAC name: 2,2-dichloro-1-(2,6-dichloro-3-pyridinyl)ethanol. InChIKey: ZCYNZBHBIOZEIE-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl4NO |
|---|---|
| Molecular weight | 260.9 g/mol |
| IUPAC name | 2,2-dichloro-1-(2,6-dichloro-3-pyridinyl)ethanol |
| InChIKey | ZCYNZBHBIOZEIE-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1C(C(Cl)Cl)O)Cl)Cl |
Computed by PubChem (NCBI)