CAS 2901083-20-1 is the registry number for 5-(2-fluorophenyl)-2-phenylpyrimidine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-(2-fluorophenyl)-2-phenylpyrimidine (CAS 2901083-20-1) is a chemical compound with the molecular formula C16H11FN2 and a molecular weight of 250.27 g/mol. IUPAC name: 5-(2-fluorophenyl)-2-phenylpyrimidine. InChIKey: UTQRGSWHQBALII-UHFFFAOYSA-N.
| Molecular formula | C16H11FN2 |
|---|---|
| Molecular weight | 250.27 g/mol |
| IUPAC name | 5-(2-fluorophenyl)-2-phenylpyrimidine |
| InChIKey | UTQRGSWHQBALII-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC=C(C=N2)C3=CC=CC=C3F |
Computed by PubChem (NCBI)