CAS 2901084-63-5 is the registry number for 3-Ethoxy-4-fluoro-5-(trimethylsilyl)benzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3-ethoxy-4-fluoro-5-trimethylsilylbenzoic acid (CAS 2901084-63-5) is a chemical compound with the molecular formula C12H17FO3Si and a molecular weight of 256.34 g/mol. IUPAC name: 3-ethoxy-4-fluoro-5-trimethylsilylbenzoic acid. InChIKey: GQWMTPBUBYKRKM-UHFFFAOYSA-N.
| Molecular formula | C12H17FO3Si |
|---|---|
| Molecular weight | 256.34 g/mol |
| IUPAC name | 3-ethoxy-4-fluoro-5-trimethylsilylbenzoic acid |
| InChIKey | GQWMTPBUBYKRKM-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C(=CC(=C1)C(=O)O)[Si](C)(C)C)F |
Computed by PubChem (NCBI)