CAS 2901085-64-9 is the registry number for 5-Bromo-2,4-dichloro-N-methoxy-N-methylbenzamide, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-bromo-2,4-dichloro-N-methoxy-N-methylbenzamide (CAS 2901085-64-9) is a chemical compound with the molecular formula C9H8BrCl2NO2 and a molecular weight of 312.97 g/mol. IUPAC name: 5-bromo-2,4-dichloro-N-methoxy-N-methylbenzamide. InChIKey: JLUOUVFWDLIFBT-UHFFFAOYSA-N.
| Molecular formula | C9H8BrCl2NO2 |
|---|---|
| Molecular weight | 312.97 g/mol |
| IUPAC name | 5-bromo-2,4-dichloro-N-methoxy-N-methylbenzamide |
| InChIKey | JLUOUVFWDLIFBT-UHFFFAOYSA-N |
| SMILES | CN(C(=O)C1=CC(=C(C=C1Cl)Cl)Br)OC |
Computed by PubChem (NCBI)