Products 2901085-76-3

CAS 2901085-76-3 is the registry number for 3-(Fluorosulfonyl)propanoic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

3-fluorosulfonylpropanoic acid (CAS 2901085-76-3) is a chemical compound with the molecular formula C3H5FO4S and a molecular weight of 156.14 g/mol. IUPAC name: 3-fluorosulfonylpropanoic acid. InChIKey: CUHPZZWFBGNHNY-UHFFFAOYSA-N.

Identity
Molecular formulaC3H5FO4S
Molecular weight156.14 g/mol
IUPAC name3-fluorosulfonylpropanoic acid
InChIKeyCUHPZZWFBGNHNY-UHFFFAOYSA-N
SMILESC(CS(=O)(=O)F)C(=O)O

Computed by PubChem (NCBI)