CAS 2901096-50-0 is the registry number for (2-(1,3-dioxolan-2-yl)-5-fluorophenyl)trimethylsilane, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
[2-(1,3-dioxolan-2-yl)-5-fluorophenyl]-trimethylsilane (CAS 2901096-50-0) is a chemical compound with the molecular formula C12H17FO2Si and a molecular weight of 240.34 g/mol. IUPAC name: [2-(1,3-dioxolan-2-yl)-5-fluorophenyl]-trimethylsilane. InChIKey: IUGQOTZDIAKIED-UHFFFAOYSA-N.
| Molecular formula | C12H17FO2Si |
|---|---|
| Molecular weight | 240.34 g/mol |
| IUPAC name | [2-(1,3-dioxolan-2-yl)-5-fluorophenyl]-trimethylsilane |
| InChIKey | IUGQOTZDIAKIED-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C1=C(C=CC(=C1)F)C2OCCO2 |
Computed by PubChem (NCBI)