CAS 2901099-42-9 is the registry number for (4-chloro-3-ethoxyphenyl)trimethylsilane, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(4-chloro-3-ethoxyphenyl)-trimethylsilane (CAS 2901099-42-9) is a chemical compound with the molecular formula C11H17ClOSi and a molecular weight of 228.79 g/mol. IUPAC name: (4-chloro-3-ethoxyphenyl)-trimethylsilane. InChIKey: LTHFEXAVRRJQPN-UHFFFAOYSA-N.
| Molecular formula | C11H17ClOSi |
|---|---|
| Molecular weight | 228.79 g/mol |
| IUPAC name | (4-chloro-3-ethoxyphenyl)-trimethylsilane |
| InChIKey | LTHFEXAVRRJQPN-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=CC(=C1)[Si](C)(C)C)Cl |
Computed by PubChem (NCBI)