CAS 2901102-85-8 is the registry number for 4-(4-bromo-3-(trifluoromethyl)phenoxy)benzonitrile, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
4-[4-bromo-3-(trifluoromethyl)phenoxy]benzonitrile (CAS 2901102-85-8) is a chemical compound with the molecular formula C14H7BrF3NO and a molecular weight of 342.11 g/mol. IUPAC name: 4-[4-bromo-3-(trifluoromethyl)phenoxy]benzonitrile. InChIKey: BPROSIDRAXFJSN-UHFFFAOYSA-N.
| Molecular formula | C14H7BrF3NO |
|---|---|
| Molecular weight | 342.11 g/mol |
| IUPAC name | 4-[4-bromo-3-(trifluoromethyl)phenoxy]benzonitrile |
| InChIKey | BPROSIDRAXFJSN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#N)OC2=CC(=C(C=C2)Br)C(F)(F)F |
Computed by PubChem (NCBI)