Products 2901103-42-0
CAS 2901103-42-0 is the registry number for 1-(cyclopent-1-en-1-yl)-2,3-difluorobenzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(cyclopenten-1-yl)-2,3-difluorobenzene (CAS 2901103-42-0) is a chemical compound with the molecular formula C11H10F2 and a molecular weight of 180.19 g/mol. IUPAC name: 1-(cyclopenten-1-yl)-2,3-difluorobenzene. InChIKey: WMUMSWFKFMULPT-UHFFFAOYSA-N.
| Molecular formula | C11H10F2 |
|---|---|
| Molecular weight | 180.19 g/mol |
| IUPAC name | 1-(cyclopenten-1-yl)-2,3-difluorobenzene |
| InChIKey | WMUMSWFKFMULPT-UHFFFAOYSA-N |
| SMILES | C1CC=C(C1)C2=C(C(=CC=C2)F)F |
Computed by PubChem (NCBI)