Products 2901105-42-6

CAS 2901105-42-6 is the registry number for 3-Fluoro-2-isobutoxy-4-methoxybenzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

3-fluoro-4-methoxy-2-(2-methylpropoxy)benzoic acid (CAS 2901105-42-6) is a chemical compound with the molecular formula C12H15FO4 and a molecular weight of 242.24 g/mol. IUPAC name: 3-fluoro-4-methoxy-2-(2-methylpropoxy)benzoic acid. InChIKey: UQKLZRVPKNKXIE-UHFFFAOYSA-N.

Identity
Molecular formulaC12H15FO4
Molecular weight242.24 g/mol
IUPAC name3-fluoro-4-methoxy-2-(2-methylpropoxy)benzoic acid
InChIKeyUQKLZRVPKNKXIE-UHFFFAOYSA-N
SMILESCC(C)COC1=C(C=CC(=C1F)OC)C(=O)O

Computed by PubChem (NCBI)