CAS 2901105-52-8 is the registry number for 2'-Bromo-5'-chloro-3'-methyl-[1,1'-biphenyl]-4-carbaldehyde, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-(2-bromo-5-chloro-3-methylphenyl)benzaldehyde (CAS 2901105-52-8) is a chemical compound with the molecular formula C14H10BrClO and a molecular weight of 309.58 g/mol. IUPAC name: 4-(2-bromo-5-chloro-3-methylphenyl)benzaldehyde. InChIKey: FYLUFSHRJQBVCP-UHFFFAOYSA-N.
| Molecular formula | C14H10BrClO |
|---|---|
| Molecular weight | 309.58 g/mol |
| IUPAC name | 4-(2-bromo-5-chloro-3-methylphenyl)benzaldehyde |
| InChIKey | FYLUFSHRJQBVCP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1Br)C2=CC=C(C=C2)C=O)Cl |
Computed by PubChem (NCBI)