CAS 2902-68-3 appears in our catalog under these names: Iodosodilactone, 95%, Iodosodilactone, Iodosodilactone, >98.0%(GC), Iodosodilactone, ≥98%, ≥98%. Offered by: Combi-blocks, GLPBio, TCI, Chemat. Available pack sizes: 1g, 250mg.
4lambda3-ioda-3,5-dioxatricyclo[5.3.1.04,11]undeca-1(11),7,9-triene-2,6-dione (CAS 2902-68-3) is a chemical compound with the molecular formula C8H3IO4 and a molecular weight of 290.01 g/mol. IUPAC name: 4lambda3-ioda-3,5-dioxatricyclo[5.3.1.04,11]undeca-1(11),7,9-triene-2,6-dione. InChIKey: DHIWEENQJCGNME-UHFFFAOYSA-N.
| Molecular formula | C8H3IO4 |
|---|---|
| Molecular weight | 290.01 g/mol |
| IUPAC name | 4lambda3-ioda-3,5-dioxatricyclo[5.3.1.04,11]undeca-1(11),7,9-triene-2,6-dione |
| InChIKey | DHIWEENQJCGNME-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C1)C(=O)OI3OC2=O |
Computed by PubChem (NCBI)