Products 2902563-75-9
CAS 2902563-75-9 is the registry number for Anticancer agent 35. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-(4-methylphenyl)sulfonyl-3-(4-thiophen-2-yl-1,3-thiazol-2-yl)urea (CAS 2902563-75-9) is a chemical compound with the molecular formula C15H13N3O3S3 and a molecular weight of 379.5 g/mol. IUPAC name: 1-(4-methylphenyl)sulfonyl-3-(4-thiophen-2-yl-1,3-thiazol-2-yl)urea. InChIKey: JYYMCJAPFDGTKU-UHFFFAOYSA-N.
| Molecular formula | C15H13N3O3S3 |
|---|---|
| Molecular weight | 379.5 g/mol |
| IUPAC name | 1-(4-methylphenyl)sulfonyl-3-(4-thiophen-2-yl-1,3-thiazol-2-yl)urea |
| InChIKey | JYYMCJAPFDGTKU-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NC(=O)NC2=NC(=CS2)C3=CC=CS3 |
Computed by PubChem (NCBI)
Synonyms:
Anticancer agent 35