Products 2902600-76-2
CAS 2902600-76-2 is the registry number for MAO-B-IN-22. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(anilinomethyl)-5-[(4-fluorophenyl)methoxy]phenol (CAS 2902600-76-2) is a chemical compound with the molecular formula C20H18FNO2 and a molecular weight of 323.4 g/mol. IUPAC name: 2-(anilinomethyl)-5-[(4-fluorophenyl)methoxy]phenol. InChIKey: PJSROCSXWXZWPV-UHFFFAOYSA-N.
| Molecular formula | C20H18FNO2 |
|---|---|
| Molecular weight | 323.4 g/mol |
| IUPAC name | 2-(anilinomethyl)-5-[(4-fluorophenyl)methoxy]phenol |
| InChIKey | PJSROCSXWXZWPV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NCC2=C(C=C(C=C2)OCC3=CC=C(C=C3)F)O |
Computed by PubChem (NCBI)