Products 2902651-89-0
CAS 2902651-89-0 is the registry number for Phenyl-glutarimide 4'-piperazine. Offered by: TargetMol. Available pack sizes: 100mg.
3-(4-piperazin-1-ylphenyl)piperidine-2,6-dione;dihydrochloride (CAS 2902651-89-0) is a chemical compound with the molecular formula C15H21Cl2N3O2 and a molecular weight of 346.2 g/mol. IUPAC name: 3-(4-piperazin-1-ylphenyl)piperidine-2,6-dione;dihydrochloride. InChIKey: DUZCAOXBUQOLHN-UHFFFAOYSA-N.
| Molecular formula | C15H21Cl2N3O2 |
|---|---|
| Molecular weight | 346.2 g/mol |
| IUPAC name | 3-(4-piperazin-1-ylphenyl)piperidine-2,6-dione;dihydrochloride |
| InChIKey | DUZCAOXBUQOLHN-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1C2=CC=C(C=C2)N3CCNCC3.Cl.Cl |
Computed by PubChem (NCBI)