Products 290294-61-0

CAS 290294-61-0 is the registry number for 1,3-Thiazole-2,4,5-tricarboxylic acid, 90%, 90%. Offered by: Chemat. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

1,3-thiazole-2,4,5-tricarboxylic acid (CAS 290294-61-0) is a chemical compound with the molecular formula C6H3NO6S and a molecular weight of 217.16 g/mol. IUPAC name: 1,3-thiazole-2,4,5-tricarboxylic acid. InChIKey: JKMPXGJJRMOELF-UHFFFAOYSA-N.

Identity
Molecular formulaC6H3NO6S
Molecular weight217.16 g/mol
IUPAC name1,3-thiazole-2,4,5-tricarboxylic acid
InChIKeyJKMPXGJJRMOELF-UHFFFAOYSA-N
SMILESC1(=C(SC(=N1)C(=O)O)C(=O)O)C(=O)O

Computed by PubChem (NCBI)