CAS 290294-61-0 is the registry number for 1,3-Thiazole-2,4,5-tricarboxylic acid, 90%, 90%. Offered by: Chemat. Available pack sizes: 1g, 5g.
1,3-thiazole-2,4,5-tricarboxylic acid (CAS 290294-61-0) is a chemical compound with the molecular formula C6H3NO6S and a molecular weight of 217.16 g/mol. IUPAC name: 1,3-thiazole-2,4,5-tricarboxylic acid. InChIKey: JKMPXGJJRMOELF-UHFFFAOYSA-N.
| Molecular formula | C6H3NO6S |
|---|---|
| Molecular weight | 217.16 g/mol |
| IUPAC name | 1,3-thiazole-2,4,5-tricarboxylic acid |
| InChIKey | JKMPXGJJRMOELF-UHFFFAOYSA-N |
| SMILES | C1(=C(SC(=N1)C(=O)O)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)