CAS 2903386-66-1 appears in our catalog under these names: 5–chloro–2–Thiothinone (hydrochloride), 5-Chloro-2-thiothinone (hydrochloride). Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 1 mg, 5 mg.
1-(5-chlorothiophen-2-yl)-2-(methylamino)propan-1-one;hydrochloride (CAS 2903386-66-1) is a chemical compound with the molecular formula C8H11Cl2NOS and a molecular weight of 240.15 g/mol. IUPAC name: 1-(5-chlorothiophen-2-yl)-2-(methylamino)propan-1-one;hydrochloride. InChIKey: SROQDMYZWYVQQR-UHFFFAOYSA-N.
| Molecular formula | C8H11Cl2NOS |
|---|---|
| Molecular weight | 240.15 g/mol |
| IUPAC name | 1-(5-chlorothiophen-2-yl)-2-(methylamino)propan-1-one;hydrochloride |
| InChIKey | SROQDMYZWYVQQR-UHFFFAOYSA-N |
| SMILES | CC(C(=O)C1=CC=C(S1)Cl)NC.Cl |
Computed by PubChem (NCBI)