Products 2903422-15-9
CAS 2903422-15-9 is the registry number for tert-Butyl (R)-4-(1-hydroxypropan-2-yl)piperidine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 4-[(2R)-1-hydroxypropan-2-yl]piperidine-1-carboxylate (CAS 2903422-15-9) is a chemical compound with the molecular formula C13H25NO3 and a molecular weight of 243.34 g/mol. IUPAC name: tert-butyl 4-[(2R)-1-hydroxypropan-2-yl]piperidine-1-carboxylate. InChIKey: QXFDQCXQLIYSKX-JTQLQIEISA-N.
| Molecular formula | C13H25NO3 |
|---|---|
| Molecular weight | 243.34 g/mol |
| IUPAC name | tert-butyl 4-[(2R)-1-hydroxypropan-2-yl]piperidine-1-carboxylate |
| InChIKey | QXFDQCXQLIYSKX-JTQLQIEISA-N |
| SMILES | C[C@@H](CO)C1CCN(CC1)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)