CAS 2903433-09-8 is the registry number for 2-((3S,5R)-4,4-Difluoro-5-methylpiperidin-3-yl)ethan-1-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(3S,5R)-4,4-difluoro-5-methylpiperidin-3-yl]ethanol (CAS 2903433-09-8) is a chemical compound with the molecular formula C8H15F2NO and a molecular weight of 179.21 g/mol. IUPAC name: 2-[(3S,5R)-4,4-difluoro-5-methylpiperidin-3-yl]ethanol. InChIKey: SPUBAUCQSWYCNF-RQJHMYQMSA-N.
| Molecular formula | C8H15F2NO |
|---|---|
| Molecular weight | 179.21 g/mol |
| IUPAC name | 2-[(3S,5R)-4,4-difluoro-5-methylpiperidin-3-yl]ethanol |
| InChIKey | SPUBAUCQSWYCNF-RQJHMYQMSA-N |
| SMILES | C[C@@H]1CNC[C@@H](C1(F)F)CCO |
Computed by PubChem (NCBI)