CAS 2903923-26-0 is the registry number for (5-Amino-4-methoxypyridin-2-yl)dimethylphosphine oxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-dimethylphosphoryl-4-methoxypyridin-3-amine (CAS 2903923-26-0) is a chemical compound with the molecular formula C8H13N2O2P and a molecular weight of 200.17 g/mol. IUPAC name: 6-dimethylphosphoryl-4-methoxypyridin-3-amine. InChIKey: DGHYUKNVELTOEP-UHFFFAOYSA-N.
| Molecular formula | C8H13N2O2P |
|---|---|
| Molecular weight | 200.17 g/mol |
| IUPAC name | 6-dimethylphosphoryl-4-methoxypyridin-3-amine |
| InChIKey | DGHYUKNVELTOEP-UHFFFAOYSA-N |
| SMILES | COC1=CC(=NC=C1N)P(=O)(C)C |
Computed by PubChem (NCBI)