CAS 2904-40-7 appears in our catalog under these names: Bis(2-carboxyethyl) isocyanurate, 98%, 3,3'-(2,4,6-Trioxo-1,3,5-triazinane-1,3-diyl)dipropionic acid, 98%, Bis(2-carboxyethyl) Isocyanurate, >98.0%(HPLC)(T), 3,3'-(2,4,6-Trioxo-1,3,5-triazinane-1,3-diyl)dipropanoic acid, 98%, 98%. Offered by: Combi-blocks, AmBeed, TCI, Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 500g, 10g, 50g, 75g.
3-[3-(2-carboxyethyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]propanoic acid (CAS 2904-40-7) is a chemical compound with the molecular formula C9H11N3O7 and a molecular weight of 273.20 g/mol. IUPAC name: 3-[3-(2-carboxyethyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]propanoic acid. InChIKey: JCUMQTAAEUDUPK-UHFFFAOYSA-N.
| Molecular formula | C9H11N3O7 |
|---|---|
| Molecular weight | 273.20 g/mol |
| IUPAC name | 3-[3-(2-carboxyethyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]propanoic acid |
| InChIKey | JCUMQTAAEUDUPK-UHFFFAOYSA-N |
| SMILES | C(CN1C(=O)NC(=O)N(C1=O)CCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)