CAS 2904571-94-2 appears in our catalog under these names: LSD1-IN-27, 98%, LSD1-IN-27/ 98.65% (existing batch purity), LSD1–IN–27, LSD1-IN-27 98%, LSD1-IN-27, 98.88%. Offered by: AmBeed, TargetMol, GLPBio, MedChemExpress, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10 mg, 25 mg.
4-N,4-N-dimethyl-1-N-(2,5,6-trimethylacridin-9-yl)benzene-1,4-diamine (CAS 2904571-94-2) is a chemical compound with the molecular formula C24H25N3 and a molecular weight of 355.5 g/mol. IUPAC name: 4-N,4-N-dimethyl-1-N-(2,5,6-trimethylacridin-9-yl)benzene-1,4-diamine. InChIKey: COFJGRODNLNWAE-UHFFFAOYSA-N.
| Molecular formula | C24H25N3 |
|---|---|
| Molecular weight | 355.5 g/mol |
| IUPAC name | 4-N,4-N-dimethyl-1-N-(2,5,6-trimethylacridin-9-yl)benzene-1,4-diamine |
| InChIKey | COFJGRODNLNWAE-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C3=C(C(=C(C=C3)C)C)N=C2C=C1)NC4=CC=C(C=C4)N(C)C |
Computed by PubChem (NCBI)